14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid

C22H34O4 — CID 162821597

IUPAC14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid
SMILESCCC=CCC=CCC(C=CC=CCC=CCCCCCC(=O)O)OO
InChIInChI=1S/C22H34O4/c1-2-3-4-5-12-15-18-21(26-25)19-16-13-10-8-6-7-9-11-14-17-20-22(23)24/h3-4,6-7,10,12-13,15-16,19,21,25H,2,5,8-9,11,14,17-18,20H2,1H3,(H,23,24)
InChIKeyXHMXFEYXNLBDKE-UHFFFAOYSA-N
MW362.51 g/mol
LogP6.24
Rot. Bonds16

About 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid

14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid (PubChem CID 162821597) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid.

Molecular Properties

Compound Name14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid
PubChem CID162821597
Molecular FormulaC22H34O4
Molecular Weight362.51 g/mol
Exact Mass362.25
IUPAC Name14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid
SMILESCCC=CCC=CCC(C=CC=CCC=CCCCCCC(=O)O)OO
InChIInChI=1S/C22H34O4/c1-2-3-4-5-12-15-18-21(26-25)19-16-13-10-8-6-7-9-11-14-17-20-22(23)24/h3-4,6-7,10,12-13,15-16,19,21,25H,2,5,8-9,11,14,17-18,20H2,1H3,(H,23,24)
InChIKeyXHMXFEYXNLBDKE-UHFFFAOYSA-N
XLogP6.24
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds16
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.51
LogP ≤ 56.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid?
The IUPAC name of 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid (CID 162821597) is 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid.
What is the SMILES notation for 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid?
The canonical SMILES for 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid is CCC=CCC=CCC(C=CC=CCC=CCCCCCC(=O)O)OO.
What is the InChIKey of 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid?
The InChIKey is XHMXFEYXNLBDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O4/c1-2-3-4-5-12-15-18-21(26-25)19-16-13-10-8-6-7-9-11-14-17-20-22(23)24/h3-4,6-7,10,12-13,15-16,19,21,25H,2,5,8-9,11,14,17-18,20H2,1H3,(H,23,24).
What are the key properties of 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid?
14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid has a molecular weight of 362.51 g/mol, XLogP of 6.24, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 14-hydroperoxydocosa-7,10,12,16,19-pentaenoic acid is sourced from PubChem (CID 162821597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).