C21H36O5 — CID 88652465
carbonic acid;12-hydroperoxyicosa-5,8,10,14-tetraene (PubChem CID 88652465) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is carbonic acid;12-hydroperoxyicosa-5,8,10,14-tetraene.
| Compound Name | carbonic acid;12-hydroperoxyicosa-5,8,10,14-tetraene |
|---|---|
| PubChem CID | 88652465 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | carbonic acid;12-hydroperoxyicosa-5,8,10,14-tetraene |
| SMILES | CCCCC=CCC=CC=CC(CC=CCCCCC)OO.O=C(O)O |
| InChI | InChI=1S/C20H34O2.CH2O3/c1-3-5-7-9-11-12-13-15-17-19-20(22-21)18-16-14-10-8-6-4-2;2-1(3)4/h9,11,13-17,19-21H,3-8,10,12,18H2,1-2H3;(H2,2,3,4) |
| InChIKey | OYYQVRFVBPPRSA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|