C20H34O2 — CID 88652466
12-hydroperoxyicosa-5,8,10,14-tetraene (PubChem CID 88652466) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 12-hydroperoxyicosa-5,8,10,14-tetraene.
| Compound Name | 12-hydroperoxyicosa-5,8,10,14-tetraene |
|---|---|
| PubChem CID | 88652466 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 12-hydroperoxyicosa-5,8,10,14-tetraene |
| SMILES | CCCCC=CCC=CC=CC(CC=CCCCCC)OO |
| InChI | InChI=1S/C20H34O2/c1-3-5-7-9-11-12-13-15-17-19-20(22-21)18-16-14-10-8-6-4-2/h9,11,13-17,19-21H,3-8,10,12,18H2,1-2H3 |
| InChIKey | BEVVLICHMWQJGC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|