C18H29O4- — CID 86289458
(6Z,8E,10R,12Z)-10-hydroperoxyoctadeca-6,8,12-trienoate (PubChem CID 86289458) has the molecular formula C18H29O4- and a molecular weight of 309.43 g/mol. Its IUPAC name is (6Z,8E,10R,12Z)-10-hydroperoxyoctadeca-6,8,12-trienoate.
| Compound Name | (6Z,8E,10R,12Z)-10-hydroperoxyoctadeca-6,8,12-trienoate |
|---|---|
| PubChem CID | 86289458 |
| Molecular Formula | C18H29O4- |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (6Z,8E,10R,12Z)-10-hydroperoxyoctadeca-6,8,12-trienoate |
| SMILES | CCCCC/C=C\C[C@H](/C=C/C=C\CCCCC(=O)[O-])OO |
| InChI | InChI=1S/C18H30O4/c1-2-3-4-5-8-11-14-17(22-21)15-12-9-6-7-10-13-16-18(19)20/h6,8-9,11-12,15,17,21H,2-5,7,10,13-14,16H2,1H3,(H,19,20)/p-1/b9-6-,11-8-,15-12+/t17-/m1/s1 |
| InChIKey | NBHLHVQEXIPLAI-NHRFXGAXSA-M |
| XLogP | 3.79 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|