C22H34O4 — CID 121295244
(8Z,10Z,13Z,15E,19Z)-17-hydroperoxydocosa-8,10,13,15,19-pentaenoic acid (PubChem CID 121295244) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (8Z,10Z,13Z,15E,19Z)-17-hydroperoxydocosa-8,10,13,15,19-pentaenoic acid.
| Compound Name | (8Z,10Z,13Z,15E,19Z)-17-hydroperoxydocosa-8,10,13,15,19-pentaenoic acid |
|---|---|
| PubChem CID | 121295244 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (8Z,10Z,13Z,15E,19Z)-17-hydroperoxydocosa-8,10,13,15,19-pentaenoic acid |
| SMILES | CC/C=C\CC(/C=C/C=C\C/C=C\C=C/CCCCCCC(=O)O)OO |
| InChI | InChI=1S/C22H34O4/c1-2-3-15-18-21(26-25)19-16-13-11-9-7-5-4-6-8-10-12-14-17-20-22(23)24/h3-7,11,13,15-16,19,21,25H,2,8-10,12,14,17-18,20H2,1H3,(H,23,24)/b6-4-,7-5-,13-11-,15-3-,19-16+ |
| InChIKey | CIAOIKHEJLLJEX-FRJMAPAXSA-N |
| XLogP | 6.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|