C11H16O2 — CID 175508843
undeca-8,10-diene-3,5-dione (PubChem CID 175508843) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is undeca-8,10-diene-3,5-dione.
| Compound Name | undeca-8,10-diene-3,5-dione |
|---|---|
| PubChem CID | 175508843 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | undeca-8,10-diene-3,5-dione |
| SMILES | C=CC=CCCC(=O)CC(=O)CC |
| InChI | InChI=1S/C11H16O2/c1-3-5-6-7-8-11(13)9-10(12)4-2/h3,5-6H,1,4,7-9H2,2H3 |
| InChIKey | ISQUWHWIQYBAER-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|