C14H24O — CID 141483115
(11Z)-tetradeca-11,13-dien-4-one (PubChem CID 141483115) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (11Z)-tetradeca-11,13-dien-4-one.
| Compound Name | (11Z)-tetradeca-11,13-dien-4-one |
|---|---|
| PubChem CID | 141483115 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (11Z)-tetradeca-11,13-dien-4-one |
| SMILES | C=C/C=C\CCCCCCC(=O)CCC |
| InChI | InChI=1S/C14H24O/c1-3-5-6-7-8-9-10-11-13-14(15)12-4-2/h3,5-6H,1,4,7-13H2,2H3/b6-5- |
| InChIKey | LMAYSCBJTJENLS-WAYWQWQTSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|