About 19-oxodocosanal
19-oxodocosanal (PubChem CID 54396259) has the molecular formula C22H42O2
and a molecular weight of 338.58 g/mol. Its IUPAC name is 19-oxodocosanal.
Molecular Properties
| Compound Name | 19-oxodocosanal |
| PubChem CID | 54396259 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 19-oxodocosanal |
| SMILES | CCCC(=O)CCCCCCCCCCCCCCCCCC=O |
| InChI | InChI=1S/C22H42O2/c1-2-19-22(24)20-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-21-23/h21H,2-20H2,1H3 |
| InChIKey | BSCNAXZBBALCRS-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 19-oxodocosanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 19-oxodocosanal?
The IUPAC name of 19-oxodocosanal (CID 54396259) is 19-oxodocosanal.
What is the SMILES notation for 19-oxodocosanal?
The canonical SMILES for 19-oxodocosanal is CCCC(=O)CCCCCCCCCCCCCCCCCC=O.
What is the InChIKey of 19-oxodocosanal?
The InChIKey is BSCNAXZBBALCRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2/c1-2-19-22(24)20-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-21-23/h21H,2-20H2,1H3.
What are the key properties of 19-oxodocosanal?
19-oxodocosanal has a molecular weight of 338.58 g/mol, XLogP of 7.19, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 19-oxodocosanal is sourced from PubChem (CID 54396259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).