About 9-oxododec-2-enal
9-oxododec-2-enal (PubChem CID 175604885) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 9-oxododec-2-enal.
Molecular Properties
| Compound Name | 9-oxododec-2-enal |
| PubChem CID | 175604885 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 9-oxododec-2-enal |
| SMILES | CCCC(=O)CCCCCC=CC=O |
| InChI | InChI=1S/C12H20O2/c1-2-9-12(14)10-7-5-3-4-6-8-11-13/h6,8,11H,2-5,7,9-10H2,1H3 |
| InChIKey | CPYPPSKPTDOVOM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 9-oxododec-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxododec-2-enal?
The IUPAC name of 9-oxododec-2-enal (CID 175604885) is 9-oxododec-2-enal.
What is the SMILES notation for 9-oxododec-2-enal?
The canonical SMILES for 9-oxododec-2-enal is CCCC(=O)CCCCCC=CC=O.
What is the InChIKey of 9-oxododec-2-enal?
The InChIKey is CPYPPSKPTDOVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-2-9-12(14)10-7-5-3-4-6-8-11-13/h6,8,11H,2-5,7,9-10H2,1H3.
What are the key properties of 9-oxododec-2-enal?
9-oxododec-2-enal has a molecular weight of 196.29 g/mol, XLogP of 3.06, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxododec-2-enal is sourced from PubChem (CID 175604885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).