C42H64O2 — CID 146373935
(17E,19E,21E,23E,27E,31E,33E,35E,37E)-dotetraconta-17,19,21,23,27,31,33,35,37-nonaene-4,9-dione (PubChem CID 146373935) has the molecular formula C42H64O2 and a molecular weight of 600.97 g/mol. Its IUPAC name is (17E,19E,21E,23E,27E,31E,33E,35E,37E)-dotetraconta-17,19,21,23,27,31,33,35,37-nonaene-4,9-dione.
| Compound Name | (17E,19E,21E,23E,27E,31E,33E,35E,37E)-dotetraconta-17,19,21,23,27,31,33,35,37-nonaene-4,9-dione |
|---|---|
| PubChem CID | 146373935 |
| Molecular Formula | C42H64O2 |
| Molecular Weight | 600.97 g/mol |
| Exact Mass | 600.49 |
| IUPAC Name | (17E,19E,21E,23E,27E,31E,33E,35E,37E)-dotetraconta-17,19,21,23,27,31,33,35,37-nonaene-4,9-dione |
| SMILES | CCCC/C=C/C=C/C=C/C=C/CC/C=C/CC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)CCCCC(=O)CCC |
| InChI | InChI=1S/C42H64O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-38-42(44)40-36-35-39-41(43)37-4-2/h7-14,17-18,21-28H,3-6,15-16,19-20,29-40H2,1-2H3/b8-7+,10-9+,12-11+,14-13+,18-17+,22-21+,24-23+,26-25+,28-27+ |
| InChIKey | JSPKTAVQFSTYRW-XJDMNOFNSA-N |
| XLogP | 12.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.97 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|