C18H29NO2 — CID 54365478
4-oxooctadeca-9,11,13-trienamide (PubChem CID 54365478) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 4-oxooctadeca-9,11,13-trienamide.
| Compound Name | 4-oxooctadeca-9,11,13-trienamide |
|---|---|
| PubChem CID | 54365478 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 4-oxooctadeca-9,11,13-trienamide |
| SMILES | CCCCC=CC=CC=CCCCCC(=O)CCC(N)=O |
| InChI | InChI=1S/C18H29NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(20)15-16-18(19)21/h5-10H,2-4,11-16H2,1H3,(H2,19,21) |
| InChIKey | UPMGDUNQUGJAPK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|