C8H13NO — CID 59663062
N-hexa-3,5-dienylacetamide (PubChem CID 59663062) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is N-hexa-3,5-dienylacetamide.
| Compound Name | N-hexa-3,5-dienylacetamide |
|---|---|
| PubChem CID | 59663062 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-hexa-3,5-dienylacetamide |
| SMILES | C=CC=CCCNC(C)=O |
| InChI | InChI=1S/C8H13NO/c1-3-4-5-6-7-9-8(2)10/h3-5H,1,6-7H2,2H3,(H,9,10) |
| InChIKey | BXXOSUJLKJQKCE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|