C11H17NO — CID 122535321
N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]acetamide (PubChem CID 122535321) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]acetamide.
| Compound Name | N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]acetamide |
|---|---|
| PubChem CID | 122535321 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]acetamide |
| SMILES | C=C/C=C\C(=C/C)CCNC(C)=O |
| InChI | InChI=1S/C11H17NO/c1-4-6-7-11(5-2)8-9-12-10(3)13/h4-7H,1,8-9H2,2-3H3,(H,12,13)/b7-6-,11-5+ |
| InChIKey | OGILEBGGTRZCJH-TUKAJDRUSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|