C12H18O3 — CID 143265968
ethane;(4Z,5Z)-4-ethylidene-2-oxoocta-5,7-dienoic acid (PubChem CID 143265968) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is ethane;(4Z,5Z)-4-ethylidene-2-oxoocta-5,7-dienoic acid.
| Compound Name | ethane;(4Z,5Z)-4-ethylidene-2-oxoocta-5,7-dienoic acid |
|---|---|
| PubChem CID | 143265968 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | ethane;(4Z,5Z)-4-ethylidene-2-oxoocta-5,7-dienoic acid |
| SMILES | C=C/C=C\C(=C/C)CC(=O)C(=O)O.CC |
| InChI | InChI=1S/C10H12O3.C2H6/c1-3-5-6-8(4-2)7-9(11)10(12)13;1-2/h3-6H,1,7H2,2H3,(H,12,13);1-2H3/b6-5-,8-4+; |
| InChIKey | XWKPQJBBTNLJFM-KCWJKURDSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|