C15H21NO5 — CID 145377840
2-[[(4Z,5Z)-4-ethylideneocta-5,7-dienoyl]amino]pentanedioic acid (PubChem CID 145377840) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-[[(4Z,5Z)-4-ethylideneocta-5,7-dienoyl]amino]pentanedioic acid.
| Compound Name | 2-[[(4Z,5Z)-4-ethylideneocta-5,7-dienoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 145377840 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[[(4Z,5Z)-4-ethylideneocta-5,7-dienoyl]amino]pentanedioic acid |
| SMILES | C=C/C=C\C(=C/C)CCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21NO5/c1-3-5-6-11(4-2)7-9-13(17)16-12(15(20)21)8-10-14(18)19/h3-6,12H,1,7-10H2,2H3,(H,16,17)(H,18,19)(H,20,21)/b6-5-,11-4+ |
| InChIKey | CLGXDCFXVFHXBW-VWXLBWAMSA-N |
| XLogP | 1.89 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|