C20H30N4O8 — CID 130433128
(2S)-2-[[(1S)-5-[[(3Z,4Z)-3-(aminomethylidene)hepta-4,6-dienoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 130433128) has the molecular formula C20H30N4O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[(3Z,4Z)-3-(aminomethylidene)hepta-4,6-dienoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[(3Z,4Z)-3-(aminomethylidene)hepta-4,6-dienoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130433128 |
| Molecular Formula | C20H30N4O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[(3Z,4Z)-3-(aminomethylidene)hepta-4,6-dienoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | C=C/C=C\C(=C/N)CC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H30N4O8/c1-2-3-6-13(12-21)11-16(25)22-10-5-4-7-14(18(28)29)23-20(32)24-15(19(30)31)8-9-17(26)27/h2-3,6,12,14-15H,1,4-5,7-11,21H2,(H,22,25)(H,26,27)(H,28,29)(H,30,31)(H2,23,24,32)/b6-3-,13-12+/t14-,15-/m0/s1 |
| InChIKey | GABHNURTEFOKKR-OSQCTDJQSA-N |
| XLogP | 0.32 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|