C30H52N6O11 — CID 175746026
2-[[1-carboxy-5-[[8-[[1-(4-formamidobutylamino)-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 175746026) has the molecular formula C30H52N6O11 and a molecular weight of 672.78 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[[8-[[1-(4-formamidobutylamino)-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[[8-[[1-(4-formamidobutylamino)-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 175746026 |
| Molecular Formula | C30H52N6O11 |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | 2-[[1-carboxy-5-[[8-[[1-(4-formamidobutylamino)-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(C)C(NC(=O)CCCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)NCCCCNC=O |
| InChI | InChI=1S/C30H52N6O11/c1-20(2)26(27(42)33-18-10-9-16-31-19-37)36-24(39)13-6-4-3-5-12-23(38)32-17-8-7-11-21(28(43)44)34-30(47)35-22(29(45)46)14-15-25(40)41/h19-22,26H,3-18H2,1-2H3,(H,31,37)(H,32,38)(H,33,42)(H,36,39)(H,40,41)(H,43,44)(H,45,46)(H2,34,35,47) |
| InChIKey | IRVNIOSULHUSHE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 269.43 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|