C29H42N4O10 — CID 122593446
2-[[1-carboxy-4-oxo-4-[[8-oxo-8-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]octyl]amino]butyl]carbamoylamino]pentanedioic acid (PubChem CID 122593446) has the molecular formula C29H42N4O10 and a molecular weight of 606.67 g/mol. Its IUPAC name is 2-[[1-carboxy-4-oxo-4-[[8-oxo-8-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]octyl]amino]butyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-4-oxo-4-[[8-oxo-8-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]octyl]amino]butyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 122593446 |
| Molecular Formula | C29H42N4O10 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 2-[[1-carboxy-4-oxo-4-[[8-oxo-8-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]octyl]amino]butyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)CCCCCCCNC(=O)CCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C29H42N4O10/c1-19(34)23(18-20-10-6-5-7-11-20)31-25(36)12-8-3-2-4-9-17-30-24(35)15-13-21(27(39)40)32-29(43)33-22(28(41)42)14-16-26(37)38/h5-7,10-11,21-23H,2-4,8-9,12-18H2,1H3,(H,30,35)(H,31,36)(H,37,38)(H,39,40)(H,41,42)(H2,32,33,43)/t21?,22?,23-/m0/s1 |
| InChIKey | FVDJSXOJOABNMI-VNXZQDSDSA-N |
| XLogP | 1.61 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|