C20H34N4O9 — CID 126497411
(2S)-2-[[(1S)-5-(6-acetamidohexanoylamino)-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 126497411) has the molecular formula C20H34N4O9 and a molecular weight of 474.51 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-(6-acetamidohexanoylamino)-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-(6-acetamidohexanoylamino)-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 126497411 |
| Molecular Formula | C20H34N4O9 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (2S)-2-[[(1S)-5-(6-acetamidohexanoylamino)-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(=O)NCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H34N4O9/c1-13(25)21-11-5-2-3-8-16(26)22-12-6-4-7-14(18(29)30)23-20(33)24-15(19(31)32)9-10-17(27)28/h14-15H,2-12H2,1H3,(H,21,25)(H,22,26)(H,27,28)(H,29,30)(H,31,32)(H2,23,24,33)/t14-,15-/m0/s1 |
| InChIKey | KQALKOFAFBDEAD-GJZGRUSLSA-N |
| XLogP | 0.04 |
| TPSA | 211.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|