C21H37N3O8 — CID 134388434
(2S)-2-[[(1S)-1-carboxy-5-(nonanoylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 134388434) has the molecular formula C21H37N3O8 and a molecular weight of 459.54 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-(nonanoylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-(nonanoylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 134388434 |
| Molecular Formula | C21H37N3O8 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-(nonanoylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CCCCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H37N3O8/c1-2-3-4-5-6-7-11-17(25)22-14-9-8-10-15(19(28)29)23-21(32)24-16(20(30)31)12-13-18(26)27/h15-16H,2-14H2,1H3,(H,22,25)(H,26,27)(H,28,29)(H,30,31)(H2,23,24,32)/t15-,16-/m0/s1 |
| InChIKey | ZKXFIYDLGXNZON-HOTGVXAUSA-N |
| XLogP | 2.09 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|