C18H30N4O9 — CID 178180266
2-[[1-carboxy-5-(5-formamidopentanoylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 178180266) has the molecular formula C18H30N4O9 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[[1-carboxy-5-(5-formamidopentanoylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-(5-formamidopentanoylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 178180266 |
| Molecular Formula | C18H30N4O9 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[[1-carboxy-5-(5-formamidopentanoylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=CNCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H30N4O9/c23-11-19-9-3-2-6-14(24)20-10-4-1-5-12(16(27)28)21-18(31)22-13(17(29)30)7-8-15(25)26/h11-13H,1-10H2,(H,19,23)(H,20,24)(H,25,26)(H,27,28)(H,29,30)(H2,21,22,31) |
| InChIKey | NOEJPFVXOWSOCX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 211.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|