C27H45N3O11 — CID 58038802
(2S)-2-[[(1S)-1-carboxy-5-[(10-carboxy-8-oxotetradecanoyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 58038802) has the molecular formula C27H45N3O11 and a molecular weight of 587.67 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[(10-carboxy-8-oxotetradecanoyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[(10-carboxy-8-oxotetradecanoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 58038802 |
| Molecular Formula | C27H45N3O11 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[(10-carboxy-8-oxotetradecanoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CCCCC(CC(=O)CCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H45N3O11/c1-2-3-10-18(24(35)36)17-19(31)11-6-4-5-7-13-22(32)28-16-9-8-12-20(25(37)38)29-27(41)30-21(26(39)40)14-15-23(33)34/h18,20-21H,2-17H2,1H3,(H,28,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H2,29,30,41)/t18?,20-,21-/m0/s1 |
| InChIKey | IVEJITNLNKCFLF-LLQWEQGGSA-N |
| XLogP | 2.53 |
| TPSA | 236.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|