C39H60N6O11 — CID 158476074
(2S)-2-[[(1S)-5-[[(10R)-14-[bis[(3-methyl-3H-pyrrol-2-yl)methyl]amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 158476074) has the molecular formula C39H60N6O11 and a molecular weight of 788.94 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[(10R)-14-[bis[(3-methyl-3H-pyrrol-2-yl)methyl]amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[(10R)-14-[bis[(3-methyl-3H-pyrrol-2-yl)methyl]amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 158476074 |
| Molecular Formula | C39H60N6O11 |
| Molecular Weight | 788.94 g/mol |
| Exact Mass | 788.43 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[(10R)-14-[bis[(3-methyl-3H-pyrrol-2-yl)methyl]amino]-10-carboxy-8-oxotetradecanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC1C=CN=C1CN(CCCC[C@H](CC(=O)CCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)CC1=NC=CC1C |
| InChI | InChI=1S/C39H60N6O11/c1-26-17-20-40-32(26)24-45(25-33-27(2)18-21-41-33)22-10-8-11-28(36(50)51)23-29(46)12-5-3-4-6-14-34(47)42-19-9-7-13-30(37(52)53)43-39(56)44-31(38(54)55)15-16-35(48)49/h17-18,20-21,26-28,30-31H,3-16,19,22-25H2,1-2H3,(H,42,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H2,43,44,56)/t26?,27?,28-,30+,31+/m1/s1 |
| InChIKey | GSYXQWVKEDLVRK-HJMUMTAFSA-N |
| XLogP | 4.03 |
| TPSA | 264.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|