C35H54N8O12Re — CID 59408612
(2S)-2-[[(1S)-5-[11-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]undecanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid;rhenium (PubChem CID 59408612) has the molecular formula C35H54N8O12Re and a molecular weight of 965.07 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[11-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]undecanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid;rhenium.
| Compound Name | (2S)-2-[[(1S)-5-[11-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]undecanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid;rhenium |
|---|---|
| PubChem CID | 59408612 |
| Molecular Formula | C35H54N8O12Re |
| Molecular Weight | 965.07 g/mol |
| Exact Mass | 965.34 |
| IUPAC Name | (2S)-2-[[(1S)-5-[11-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]undecanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid;rhenium |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CCCCCCCCCCN(Cc1nccn1CC(=O)O)Cc1nccn1CC(=O)O)C(=O)O)C(=O)O.[Re] |
| InChI | InChI=1S/C35H54N8O12.Re/c44-29(38-15-9-8-11-25(33(51)52)39-35(55)40-26(34(53)54)13-14-30(45)46)12-7-5-3-1-2-4-6-10-18-41(21-27-36-16-19-42(27)23-31(47)48)22-28-37-17-20-43(28)24-32(49)50;/h16-17,19-20,25-26H,1-15,18,21-24H2,(H,38,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H2,39,40,55);/t25-,26-;/m0./s1 |
| InChIKey | PCHOMCBFQXUAGR-CCQIZPNASA-N |
| XLogP | 2.12 |
| TPSA | 295.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.07 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|