C30H39N9O12S — CID 77408736
6-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]-2-[[4-carboxy-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 77408736) has the molecular formula C30H39N9O12S and a molecular weight of 749.76 g/mol. Its IUPAC name is 6-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]-2-[[4-carboxy-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | 6-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]-2-[[4-carboxy-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 77408736 |
| Molecular Formula | C30H39N9O12S |
| Molecular Weight | 749.76 g/mol |
| Exact Mass | 749.24 |
| IUPAC Name | 6-[bis[[1-(carboxymethyl)imidazol-2-yl]methyl]amino]-2-[[4-carboxy-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(CCC(=O)O)NC(=O)NC(CCCCN(Cc2nccn2CC(=O)O)Cc2nccn2CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C30H39N9O12S/c31-52(50,51)20-6-4-19(5-7-20)34-28(46)21(8-9-25(40)41)35-30(49)36-22(29(47)48)3-1-2-12-37(15-23-32-10-13-38(23)17-26(42)43)16-24-33-11-14-39(24)18-27(44)45/h4-7,10-11,13-14,21-22H,1-3,8-9,12,15-18H2,(H,34,46)(H,40,41)(H,42,43)(H,44,45)(H,47,48)(H2,31,50,51)(H2,35,36,49) |
| InChIKey | OVLYYFCNISJEHI-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 318.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.76 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|