C25H31IN6O8S2 — CID 89061903
(2S)-2-[[(2S)-4-carboxy-1-(4-iodoanilino)-1-oxobutan-2-yl]carbamoylamino]-6-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid (PubChem CID 89061903) has the molecular formula C25H31IN6O8S2 and a molecular weight of 734.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-carboxy-1-(4-iodoanilino)-1-oxobutan-2-yl]carbamoylamino]-6-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-carboxy-1-(4-iodoanilino)-1-oxobutan-2-yl]carbamoylamino]-6-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid |
|---|---|
| PubChem CID | 89061903 |
| Molecular Formula | C25H31IN6O8S2 |
| Molecular Weight | 734.60 g/mol |
| Exact Mass | 734.07 |
| IUPAC Name | (2S)-2-[[(2S)-4-carboxy-1-(4-iodoanilino)-1-oxobutan-2-yl]carbamoylamino]-6-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)Nc2ccc(I)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H31IN6O8S2/c26-15-4-6-16(7-5-15)29-22(35)19(12-13-21(33)34)31-24(38)32-20(23(36)37)3-1-2-14-28-25(41)30-17-8-10-18(11-9-17)42(27,39)40/h4-11,19-20H,1-3,12-14H2,(H,29,35)(H,33,34)(H,36,37)(H2,27,39,40)(H2,28,30,41)(H2,31,32,38)/t19-,20-/m0/s1 |
| InChIKey | APMYKYORLYCMJO-PMACEKPBSA-N |
| XLogP | 2.02 |
| TPSA | 229.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|