C13H20N4O4S2 — CID 10594692
(2S)-6-amino-2-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid (PubChem CID 10594692) has the molecular formula C13H20N4O4S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (2S)-6-amino-2-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid |
|---|---|
| PubChem CID | 10594692 |
| Molecular Formula | C13H20N4O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (2S)-6-amino-2-[(4-sulfamoylphenyl)carbamothioylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=S)Nc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H20N4O4S2/c14-8-2-1-3-11(12(18)19)17-13(22)16-9-4-6-10(7-5-9)23(15,20)21/h4-7,11H,1-3,8,14H2,(H,18,19)(H2,15,20,21)(H2,16,17,22)/t11-/m0/s1 |
| InChIKey | BWAPUKBOGBNVIL-NSHDSACASA-N |
| XLogP | 0.20 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|