C13H15N5O4S2 — CID 4073057
3-(1H-imidazol-5-yl)-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid (PubChem CID 4073057) has the molecular formula C13H15N5O4S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 4073057 |
| Molecular Formula | C13H15N5O4S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(Cc2cnc[nH]2)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15N5O4S2/c14-24(21,22)10-3-1-8(2-4-10)17-13(23)18-11(12(19)20)5-9-6-15-7-16-9/h1-4,6-7,11H,5H2,(H,15,16)(H,19,20)(H2,14,21,22)(H2,17,18,23) |
| InChIKey | AVBKDDMBXOWRIO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|