C13H12F3N3O4S — CID 67277167
3-(1H-imidazol-5-yl)-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 67277167) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 67277167 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)C(Cc1cnc[nH]1)NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F3N3O4S/c14-13(15,16)8-1-3-10(4-2-8)24(22,23)19-11(12(20)21)5-9-6-17-7-18-9/h1-4,6-7,11,19H,5H2,(H,17,18)(H,20,21) |
| InChIKey | GUQYFEWSKCRMRN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |