C13H13N3O5S — CID 89326469
2-[(2-formylphenyl)sulfonylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 89326469) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-[(2-formylphenyl)sulfonylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[(2-formylphenyl)sulfonylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 89326469 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[(2-formylphenyl)sulfonylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | O=Cc1ccccc1S(=O)(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C13H13N3O5S/c17-7-9-3-1-2-4-12(9)22(20,21)16-11(13(18)19)5-10-6-14-8-15-10/h1-4,6-8,11,16H,5H2,(H,14,15)(H,18,19) |
| InChIKey | CCGYGYNHIXMDFF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|