C14H14F3N3O3 — CID 167937215
2-[[2-hydroxy-4-(trifluoromethyl)phenyl]methylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 167937215) has the molecular formula C14H14F3N3O3 and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-[[2-hydroxy-4-(trifluoromethyl)phenyl]methylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-hydroxy-4-(trifluoromethyl)phenyl]methylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 167937215 |
| Molecular Formula | C14H14F3N3O3 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[[2-hydroxy-4-(trifluoromethyl)phenyl]methylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1cnc[nH]1)NCc1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C14H14F3N3O3/c15-14(16,17)9-2-1-8(12(21)3-9)5-19-11(13(22)23)4-10-6-18-7-20-10/h1-3,6-7,11,19,21H,4-5H2,(H,18,20)(H,22,23) |
| InChIKey | MMVHWDBSZTYKFO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|