C24H28FeN6O4+2 — CID 71502130
CID 71502130 (PubChem CID 71502130) has the molecular formula C24H28FeN6O4+2 and a molecular weight of 520.37 g/mol.
| Compound Name | CID 71502130 |
|---|---|
| PubChem CID | 71502130 |
| Molecular Formula | C24H28FeN6O4+2 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@H](Cc1cnc[nH]1)NC[C]1[CH][CH][CH][CH]1.O=C(O)[C@H](Cc1cnc[nH]1)NC[C]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/2C12H14N3O2.Fe/c2*16-12(17)11(5-10-7-13-8-15-10)14-6-9-3-1-2-4-9;/h2*1-4,7-8,11,14H,5-6H2,(H,13,15)(H,16,17);/q;;+2/t2*11-;/m00./s1 |
| InChIKey | BZZAIQPZDHBOAB-ISAZSYCMSA-N |
| XLogP | 0.80 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|