C16H22N2O5S — CID 140523075
2-[(4-methoxyphenyl)carbamothioylamino]octanedioic acid (PubChem CID 140523075) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)carbamothioylamino]octanedioic acid.
| Compound Name | 2-[(4-methoxyphenyl)carbamothioylamino]octanedioic acid |
|---|---|
| PubChem CID | 140523075 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[(4-methoxyphenyl)carbamothioylamino]octanedioic acid |
| SMILES | COc1ccc(NC(=S)NC(CCCCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-23-12-9-7-11(8-10-12)17-16(24)18-13(15(21)22)5-3-2-4-6-14(19)20/h7-10,13H,2-6H2,1H3,(H,19,20)(H,21,22)(H2,17,18,24) |
| InChIKey | BKMNATOFQXUCNQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|