C15H19BrN2O5 — CID 91541031
2-[(4-bromophenyl)carbamoylamino]octanedioic acid (PubChem CID 91541031) has the molecular formula C15H19BrN2O5 and a molecular weight of 387.23 g/mol. Its IUPAC name is 2-[(4-bromophenyl)carbamoylamino]octanedioic acid.
| Compound Name | 2-[(4-bromophenyl)carbamoylamino]octanedioic acid |
|---|---|
| PubChem CID | 91541031 |
| Molecular Formula | C15H19BrN2O5 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2-[(4-bromophenyl)carbamoylamino]octanedioic acid |
| SMILES | O=C(O)CCCCCC(NC(=O)Nc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C15H19BrN2O5/c16-10-6-8-11(9-7-10)17-15(23)18-12(14(21)22)4-2-1-3-5-13(19)20/h6-9,12H,1-5H2,(H,19,20)(H,21,22)(H2,17,18,23) |
| InChIKey | DTFOJUALKANZAQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|