C10H14N4O5 — CID 114007193
(2R)-2-(1H-pyrazol-4-ylcarbamoylamino)hexanedioic acid (PubChem CID 114007193) has the molecular formula C10H14N4O5 and a molecular weight of 270.24 g/mol. Its IUPAC name is (2R)-2-(1H-pyrazol-4-ylcarbamoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(1H-pyrazol-4-ylcarbamoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 114007193 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2R)-2-(1H-pyrazol-4-ylcarbamoylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)Nc1cn[nH]c1)C(=O)O |
| InChI | InChI=1S/C10H14N4O5/c15-8(16)3-1-2-7(9(17)18)14-10(19)13-6-4-11-12-5-6/h4-5,7H,1-3H2,(H,11,12)(H,15,16)(H,17,18)(H2,13,14,19)/t7-/m1/s1 |
| InChIKey | RWLZAUFFYZCLNX-SSDOTTSWSA-N |
| XLogP | 0.24 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |