C10H15N5O5 — CID 107840195
(2R)-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)hexanedioic acid (PubChem CID 107840195) has the molecular formula C10H15N5O5 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2R)-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 107840195 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2R)-2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)NCc1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C10H15N5O5/c16-8(17)3-1-2-6(9(18)19)14-10(20)11-4-7-12-5-13-15-7/h5-6H,1-4H2,(H,16,17)(H,18,19)(H2,11,14,20)(H,12,13,15)/t6-/m1/s1 |
| InChIKey | WODTXPZVXYCWJT-ZCFIWIBFSA-N |
| XLogP | -0.69 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |