C12H17N3O5S — CID 107839056
(2R)-2-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]hexanedioic acid (PubChem CID 107839056) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is (2R)-2-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]hexanedioic acid.
| Compound Name | (2R)-2-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]hexanedioic acid |
|---|---|
| PubChem CID | 107839056 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2R)-2-[(2-methyl-1,3-thiazol-5-yl)methylcarbamoylamino]hexanedioic acid |
| SMILES | Cc1ncc(CNC(=O)N[C@H](CCCC(=O)O)C(=O)O)s1 |
| InChI | InChI=1S/C12H17N3O5S/c1-7-13-5-8(21-7)6-14-12(20)15-9(11(18)19)3-2-4-10(16)17/h5,9H,2-4,6H2,1H3,(H,16,17)(H,18,19)(H2,14,15,20)/t9-/m1/s1 |
| InChIKey | YKEWZVIOVXMGDW-SECBINFHSA-N |
| XLogP | 0.96 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |