(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid

C11H15N3O5S — CID 107839059

IUPAC(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid
SMILESO=C(O)CCC[C@@H](NC(=O)NCc1nccs1)C(=O)O
InChIInChI=1S/C11H15N3O5S/c15-9(16)3-1-2-7(10(17)18)14-11(19)13-6-8-12-4-5-20-8/h4-5,7H,1-3,6H2,(H,15,16)(H,17,18)(H2,13,14,19)/t7-/m1/s1
InChIKeyCMUOGKQJINAUHC-SSDOTTSWSA-N
MW301.32 g/mol
LogP0.65
Rot. Bonds8

About (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid

(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid (PubChem CID 107839059) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid.

Molecular Properties

Compound Name(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid
PubChem CID107839059
Molecular FormulaC11H15N3O5S
Molecular Weight301.32 g/mol
Exact Mass301.07
IUPAC Name(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid
SMILESO=C(O)CCC[C@@H](NC(=O)NCc1nccs1)C(=O)O
InChIInChI=1S/C11H15N3O5S/c15-9(16)3-1-2-7(10(17)18)14-11(19)13-6-8-12-4-5-20-8/h4-5,7H,1-3,6H2,(H,15,16)(H,17,18)(H2,13,14,19)/t7-/m1/s1
InChIKeyCMUOGKQJINAUHC-SSDOTTSWSA-N
XLogP0.65
TPSA128.62 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.32
LogP ≤ 50.65
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid?
The IUPAC name of (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid (CID 107839059) is (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid.
What is the SMILES notation for (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid?
The canonical SMILES for (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid is O=C(O)CCC[C@@H](NC(=O)NCc1nccs1)C(=O)O.
What is the InChIKey of (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid?
The InChIKey is CMUOGKQJINAUHC-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H15N3O5S/c15-9(16)3-1-2-7(10(17)18)14-11(19)13-6-8-12-4-5-20-8/h4-5,7H,1-3,6H2,(H,15,16)(H,17,18)(H2,13,14,19)/t7-/m1/s1.
What are the key properties of (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid?
(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid has a molecular weight of 301.32 g/mol, XLogP of 0.65, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid is sourced from PubChem (CID 107839059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).