C11H15N3O5S — CID 107839059
(2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid (PubChem CID 107839059) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 107839059 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2R)-2-(1,3-thiazol-2-ylmethylcarbamoylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)NCc1nccs1)C(=O)O |
| InChI | InChI=1S/C11H15N3O5S/c15-9(16)3-1-2-7(10(17)18)14-11(19)13-6-8-12-4-5-20-8/h4-5,7H,1-3,6H2,(H,15,16)(H,17,18)(H2,13,14,19)/t7-/m1/s1 |
| InChIKey | CMUOGKQJINAUHC-SSDOTTSWSA-N |
| XLogP | 0.65 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |