C12H19N3O3S — CID 114128702
5-[(5-methyl-1,3-thiazol-2-yl)methylcarbamoylamino]hexanoic acid (PubChem CID 114128702) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 5-[(5-methyl-1,3-thiazol-2-yl)methylcarbamoylamino]hexanoic acid.
| Compound Name | 5-[(5-methyl-1,3-thiazol-2-yl)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 114128702 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-[(5-methyl-1,3-thiazol-2-yl)methylcarbamoylamino]hexanoic acid |
| SMILES | Cc1cnc(CNC(=O)NC(C)CCCC(=O)O)s1 |
| InChI | InChI=1S/C12H19N3O3S/c1-8(4-3-5-11(16)17)15-12(18)14-7-10-13-6-9(2)19-10/h6,8H,3-5,7H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | DROBXLJWXJKNBR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |