C16H21N3O2S — CID 111506869
1-(4-hydroxy-1-phenylbutyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea (PubChem CID 111506869) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(4-hydroxy-1-phenylbutyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea.
| Compound Name | 1-(4-hydroxy-1-phenylbutyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 111506869 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(4-hydroxy-1-phenylbutyl)-3-[(5-methyl-1,3-thiazol-2-yl)methyl]urea |
| SMILES | Cc1cnc(CNC(=O)NC(CCCO)c2ccccc2)s1 |
| InChI | InChI=1S/C16H21N3O2S/c1-12-10-17-15(22-12)11-18-16(21)19-14(8-5-9-20)13-6-3-2-4-7-13/h2-4,6-7,10,14,20H,5,8-9,11H2,1H3,(H2,18,19,21) |
| InChIKey | DSOPWGQAFZZOOU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |