C16H22N4O2 — CID 111454513
1-(4-hydroxy-1-phenylbutyl)-3-[(2-methylpyrazol-3-yl)methyl]urea (PubChem CID 111454513) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(4-hydroxy-1-phenylbutyl)-3-[(2-methylpyrazol-3-yl)methyl]urea.
| Compound Name | 1-(4-hydroxy-1-phenylbutyl)-3-[(2-methylpyrazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 111454513 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(4-hydroxy-1-phenylbutyl)-3-[(2-methylpyrazol-3-yl)methyl]urea |
| SMILES | Cn1nccc1CNC(=O)NC(CCCO)c1ccccc1 |
| InChI | InChI=1S/C16H22N4O2/c1-20-14(9-10-18-20)12-17-16(22)19-15(8-5-11-21)13-6-3-2-4-7-13/h2-4,6-7,9-10,15,21H,5,8,11-12H2,1H3,(H2,17,19,22) |
| InChIKey | ZFEHFTKFQWTCBF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |