C11H14N2O5S — CID 55175256
2-(thiophen-3-ylmethylcarbamoylamino)pentanedioic acid (PubChem CID 55175256) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(thiophen-3-ylmethylcarbamoylamino)pentanedioic acid.
| Compound Name | 2-(thiophen-3-ylmethylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 55175256 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(thiophen-3-ylmethylcarbamoylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NCc1ccsc1)C(=O)O |
| InChI | InChI=1S/C11H14N2O5S/c14-9(15)2-1-8(10(16)17)13-11(18)12-5-7-3-4-19-6-7/h3-4,6,8H,1-2,5H2,(H,14,15)(H,16,17)(H2,12,13,18) |
| InChIKey | BXMPIMSCSNIWHH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |