C13H20N2O3S — CID 63244412
7-(thiophen-3-ylmethylcarbamoylamino)heptanoic acid (PubChem CID 63244412) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 7-(thiophen-3-ylmethylcarbamoylamino)heptanoic acid.
| Compound Name | 7-(thiophen-3-ylmethylcarbamoylamino)heptanoic acid |
|---|---|
| PubChem CID | 63244412 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 7-(thiophen-3-ylmethylcarbamoylamino)heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)NCc1ccsc1 |
| InChI | InChI=1S/C13H20N2O3S/c16-12(17)5-3-1-2-4-7-14-13(18)15-9-11-6-8-19-10-11/h6,8,10H,1-5,7,9H2,(H,16,17)(H2,14,15,18) |
| InChIKey | GFSVDQWEWPXJCY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|