C13H17N3O5 — CID 62309110
(2S)-2-[(6-methyl-2-pyridinyl)methylcarbamoylamino]pentanedioic acid (PubChem CID 62309110) has the molecular formula C13H17N3O5 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2S)-2-[(6-methyl-2-pyridinyl)methylcarbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(6-methyl-2-pyridinyl)methylcarbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 62309110 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2S)-2-[(6-methyl-2-pyridinyl)methylcarbamoylamino]pentanedioic acid |
| SMILES | Cc1cccc(CNC(=O)N[C@@H](CCC(=O)O)C(=O)O)n1 |
| InChI | InChI=1S/C13H17N3O5/c1-8-3-2-4-9(15-8)7-14-13(21)16-10(12(19)20)5-6-11(17)18/h2-4,10H,5-7H2,1H3,(H,17,18)(H,19,20)(H2,14,16,21)/t10-/m0/s1 |
| InChIKey | VKVOPEDVXHSYMI-JTQLQIEISA-N |
| XLogP | 0.51 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |