C17H21N3O2 — CID 99635583
1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(6-methyl-2-pyridinyl)methyl]urea (PubChem CID 99635583) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(6-methyl-2-pyridinyl)methyl]urea.
| Compound Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(6-methyl-2-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 99635583 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(6-methyl-2-pyridinyl)methyl]urea |
| SMILES | Cc1cccc(CNC(=O)N[C@H](CO)Cc2ccccc2)n1 |
| InChI | InChI=1S/C17H21N3O2/c1-13-6-5-9-15(19-13)11-18-17(22)20-16(12-21)10-14-7-3-2-4-8-14/h2-9,16,21H,10-12H2,1H3,(H2,18,20,22)/t16-/m0/s1 |
| InChIKey | MSWQKLQVOKXAQS-INIZCTEOSA-N |
| XLogP | 1.79 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |