C19H24N2O3 — CID 22088923
1,3-bis(1-hydroxy-3-phenylpropan-2-yl)urea (PubChem CID 22088923) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1,3-bis(1-hydroxy-3-phenylpropan-2-yl)urea.
| Compound Name | 1,3-bis(1-hydroxy-3-phenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 22088923 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1,3-bis(1-hydroxy-3-phenylpropan-2-yl)urea |
| SMILES | O=C(NC(CO)Cc1ccccc1)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O3/c22-13-17(11-15-7-3-1-4-8-15)20-19(24)21-18(14-23)12-16-9-5-2-6-10-16/h1-10,17-18,22-23H,11-14H2,(H2,20,21,24) |
| InChIKey | XOXXRWKSAKHXHV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |