C23H34N4O — CID 124628917
1,3-bis[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]urea (PubChem CID 124628917) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 1,3-bis[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]urea.
| Compound Name | 1,3-bis[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 124628917 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1,3-bis[(2R)-1-(dimethylamino)-3-phenylpropan-2-yl]urea |
| SMILES | CN(C)C[C@@H](Cc1ccccc1)NC(=O)N[C@H](Cc1ccccc1)CN(C)C |
| InChI | InChI=1S/C23H34N4O/c1-26(2)17-21(15-19-11-7-5-8-12-19)24-23(28)25-22(18-27(3)4)16-20-13-9-6-10-14-20/h5-14,21-22H,15-18H2,1-4H3,(H2,24,25,28)/t21-,22-/m1/s1 |
| InChIKey | ABQUHHWTKXTADS-FGZHOGPDSA-N |
| XLogP | 2.63 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |