C20H32N4O3 — CID 60547220
ethyl 4-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 60547220) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is ethyl 4-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 60547220 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | ethyl 4-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)NC(Cc2ccccc2)CN(C)C)CC1 |
| InChI | InChI=1S/C20H32N4O3/c1-4-27-20(26)24-12-10-17(11-13-24)21-19(25)22-18(15-23(2)3)14-16-8-6-5-7-9-16/h5-9,17-18H,4,10-15H2,1-3H3,(H2,21,22,25) |
| InChIKey | BCLXFIAIVYUGEO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |