C20H31N3O3 — CID 60547124
ethyl 1-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoyl]piperidine-4-carboxylate (PubChem CID 60547124) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is ethyl 1-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 60547124 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | ethyl 1-[[1-(dimethylamino)-3-phenylpropan-2-yl]carbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NC(Cc2ccccc2)CN(C)C)CC1 |
| InChI | InChI=1S/C20H31N3O3/c1-4-26-19(24)17-10-12-23(13-11-17)20(25)21-18(15-22(2)3)14-16-8-6-5-7-9-16/h5-9,17-18H,4,10-15H2,1-3H3,(H,21,25) |
| InChIKey | JFKGITKNXFSDIJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |