C18H24ClN3O — CID 117067649
4-amino-N-[1-(dimethylamino)-3-phenylpropan-2-yl]benzamide;hydrochloride (PubChem CID 117067649) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 4-amino-N-[1-(dimethylamino)-3-phenylpropan-2-yl]benzamide;hydrochloride.
| Compound Name | 4-amino-N-[1-(dimethylamino)-3-phenylpropan-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 117067649 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-amino-N-[1-(dimethylamino)-3-phenylpropan-2-yl]benzamide;hydrochloride |
| SMILES | CN(C)CC(Cc1ccccc1)NC(=O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C18H23N3O.ClH/c1-21(2)13-17(12-14-6-4-3-5-7-14)20-18(22)15-8-10-16(19)11-9-15;/h3-11,17H,12-13,19H2,1-2H3,(H,20,22);1H |
| InChIKey | CWNRWYOFQCCAKH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|